C11H14N2 — CID 11093867
3-(4-ethyliminocyclohexa-2,5-dien-1-yl)propanenitrile (PubChem CID 11093867) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3-(4-ethyliminocyclohexa-2,5-dien-1-yl)propanenitrile.
| Compound Name | 3-(4-ethyliminocyclohexa-2,5-dien-1-yl)propanenitrile |
|---|---|
| PubChem CID | 11093867 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-(4-ethyliminocyclohexa-2,5-dien-1-yl)propanenitrile |
| SMILES | CCN=C1C=CC(CCC#N)C=C1 |
| InChI | InChI=1S/C11H14N2/c1-2-13-11-7-5-10(6-8-11)4-3-9-12/h5-8,10H,2-4H2,1H3/b13-11- |
| InChIKey | MCHNOCDAEVHHEZ-QBFSEMIESA-N |
| XLogP | 2.49 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|