C9H15N — CID 90941933
6-methyl-3-propyl-2,3-dihydropyridine (PubChem CID 90941933) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 6-methyl-3-propyl-2,3-dihydropyridine.
| Compound Name | 6-methyl-3-propyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 90941933 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 6-methyl-3-propyl-2,3-dihydropyridine |
| SMILES | CCCC1C=CC(C)=NC1 |
| InChI | InChI=1S/C9H15N/c1-3-4-9-6-5-8(2)10-7-9/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | DDKBOTYFRAXBKK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |