C50H60N2O8 — CID 11094043
bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] octanedioate (PubChem CID 11094043) has the molecular formula C50H60N2O8 and a molecular weight of 817.04 g/mol. Its IUPAC name is bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] octanedioate.
| Compound Name | bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] octanedioate |
|---|---|
| PubChem CID | 11094043 |
| Molecular Formula | C50H60N2O8 |
| Molecular Weight | 817.04 g/mol |
| Exact Mass | 816.43 |
| IUPAC Name | bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] octanedioate |
| SMILES | CC(C)[C@H]1C(=O)N2[C@H](COC2(C)C)[C@H]1c1ccc(OC(=O)CCCCCCC(=O)Oc2ccc([C@H]3[C@@H](C(C)C)C(=O)N4[C@@H]3COC4(C)C)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C50H60N2O8/c1-29(2)43-45(37-27-57-49(5,6)51(37)47(43)55)35-23-25-39(33-19-15-13-17-31(33)35)59-41(53)21-11-9-10-12-22-42(54)60-40-26-24-36(32-18-14-16-20-34(32)40)46-38-28-58-50(7,8)52(38)48(56)44(46)30(3)4/h13-20,23-26,29-30,37-38,43-46H,9-12,21-22,27-28H2,1-8H3/t37-,38-,43-,44-,45-,46-/m1/s1 |
| InChIKey | GFXZJNFXCGXEHO-BPLZTPAFSA-N |
| XLogP | 9.51 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.04 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|