C15H23F2N3O — CID 110945336
1-butan-2-yl-3-[[3-(2,2-difluoroethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 110945336) has the molecular formula C15H23F2N3O and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-butan-2-yl-3-[[3-(2,2-difluoroethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-butan-2-yl-3-[[3-(2,2-difluoroethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110945336 |
| Molecular Formula | C15H23F2N3O |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1-butan-2-yl-3-[[3-(2,2-difluoroethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | CCC(C)N/C(=N\C)NCc1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C15H23F2N3O/c1-4-11(2)20-15(18-3)19-9-12-6-5-7-13(8-12)21-10-14(16)17/h5-8,11,14H,4,9-10H2,1-3H3,(H2,18,19,20) |
| InChIKey | QNPPXPIMHHCTCO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|