C21H24F5N3O2 — CID 111857420
1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111857420) has the molecular formula C21H24F5N3O2 and a molecular weight of 445.43 g/mol. Its IUPAC name is 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111857420 |
| Molecular Formula | C21H24F5N3O2 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(COCC(F)(F)F)cc1)NCc1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C21H24F5N3O2/c1-27-20(29-11-17-3-2-4-18(9-17)31-13-19(22)23)28-10-15-5-7-16(8-6-15)12-30-14-21(24,25)26/h2-9,19H,10-14H2,1H3,(H2,27,28,29) |
| InChIKey | VDCWOQUJJDBZDQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|