C14H28IN5 — CID 110945595
1-butan-2-yl-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 110945595) has the molecular formula C14H28IN5 and a molecular weight of 393.32 g/mol. Its IUPAC name is 1-butan-2-yl-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110945595 |
| Molecular Formula | C14H28IN5 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-butan-2-yl-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCC(C)N/C(=N\C)NCCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C14H27N5.HI/c1-7-10(2)17-14(15-5)16-9-8-13-11(3)18-19(6)12(13)4;/h10H,7-9H2,1-6H3,(H2,15,16,17);1H |
| InChIKey | PBLURNUIYMCMNA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|