C21H41IN6 — CID 111937060
1-[2-(azepan-1-yl)-3-methylbutyl]-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111937060) has the molecular formula C21H41IN6 and a molecular weight of 504.51 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-3-methylbutyl]-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111937060 |
| Molecular Formula | C21H41IN6 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1c(C)nn(C)c1C)NCC(C(C)C)N1CCCCCC1.I |
| InChI | InChI=1S/C21H40N6.HI/c1-16(2)20(27-13-9-7-8-10-14-27)15-24-21(22-5)23-12-11-19-17(3)25-26(6)18(19)4;/h16,20H,7-15H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | PTBYWILCTNVQMZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|