C17H25IN4O — CID 110946707
N-[2-[[C-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 110946707) has the molecular formula C17H25IN4O and a molecular weight of 428.32 g/mol. Its IUPAC name is N-[2-[[C-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[C-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 110946707 |
| Molecular Formula | C17H25IN4O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[2-[[C-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C1CC1)N1CCc2ccccc2C1.I |
| InChI | InChI=1S/C17H24N4O.HI/c1-18-17(20-10-9-19-16(22)14-6-7-14)21-11-8-13-4-2-3-5-15(13)12-21;/h2-5,14H,6-12H2,1H3,(H,18,20)(H,19,22);1H |
| InChIKey | MGTJHUKHGJFRKK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|