About Bis(dimethylsilyl)ethyne
Bis(dimethylsilyl)ethyne (PubChem CID 11094730) has the molecular formula C6H12Si2
and a molecular weight of 140.33 g/mol.
Molecular Properties
| Compound Name | Bis(dimethylsilyl)ethyne |
| PubChem CID | 11094730 |
| Molecular Formula | C6H12Si2 |
| Molecular Weight | 140.33 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | — |
| SMILES | C[Si](C)C#C[Si](C)C |
| InChI | InChI=1S/C6H12Si2/c1-7(2)5-6-8(3)4/h1-4H3 |
| InChIKey | IXVVJNMYHZOAGJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze Bis(dimethylsilyl)ethyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bis(dimethylsilyl)ethyne?
The IUPAC name of Bis(dimethylsilyl)ethyne (CID 11094730) is not available.
What is the SMILES notation for Bis(dimethylsilyl)ethyne?
The canonical SMILES for Bis(dimethylsilyl)ethyne is C[Si](C)C#C[Si](C)C.
What is the InChIKey of Bis(dimethylsilyl)ethyne?
The InChIKey is IXVVJNMYHZOAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Si2/c1-7(2)5-6-8(3)4/h1-4H3.
What are the key properties of Bis(dimethylsilyl)ethyne?
Bis(dimethylsilyl)ethyne has a molecular weight of 140.33 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Bis(dimethylsilyl)ethyne is sourced from PubChem (CID 11094730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).