About 6,6-dimethoxyhexanal
6,6-dimethoxyhexanal (PubChem CID 11094926) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 6,6-dimethoxyhexanal.
Molecular Properties
| Compound Name | 6,6-dimethoxyhexanal |
| PubChem CID | 11094926 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 6,6-dimethoxyhexanal |
| SMILES | COC(CCCCC=O)OC |
| InChI | InChI=1S/C8H16O3/c1-10-8(11-2)6-4-3-5-7-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | MYGCEGWHEVJNCR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethoxyhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethoxyhexanal?
The IUPAC name of 6,6-dimethoxyhexanal (CID 11094926) is 6,6-dimethoxyhexanal.
What is the SMILES notation for 6,6-dimethoxyhexanal?
The canonical SMILES for 6,6-dimethoxyhexanal is COC(CCCCC=O)OC.
What is the InChIKey of 6,6-dimethoxyhexanal?
The InChIKey is MYGCEGWHEVJNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-10-8(11-2)6-4-3-5-7-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 6,6-dimethoxyhexanal?
6,6-dimethoxyhexanal has a molecular weight of 160.21 g/mol, XLogP of 1.36, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethoxyhexanal is sourced from PubChem (CID 11094926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).