C20H25N3O2 — CID 110949286
1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methyl-3-(1-phenylethyl)guanidine (PubChem CID 110949286) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methyl-3-(1-phenylethyl)guanidine.
| Compound Name | 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methyl-3-(1-phenylethyl)guanidine |
|---|---|
| PubChem CID | 110949286 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methyl-3-(1-phenylethyl)guanidine |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCCO2)NC(C)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O2/c1-15(17-6-4-3-5-7-17)23-20(21-2)22-11-10-16-8-9-18-19(14-16)25-13-12-24-18/h3-9,14-15H,10-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | ZZLDDUCIHSWXHW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|