C12H18N4O2 — CID 116510665
1-amino-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methylguanidine (PubChem CID 116510665) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-amino-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-amino-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 116510665 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-amino-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NN)NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H18N4O2/c1-14-12(16-13)15-5-4-9-2-3-10-11(8-9)18-7-6-17-10/h2-3,8H,4-7,13H2,1H3,(H2,14,15,16) |
| InChIKey | KTXAAPOOGZIEIT-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|