C21H30N4O2S — CID 110950418
1-benzyl-1,2-dimethyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine (PubChem CID 110950418) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine.
| Compound Name | 1-benzyl-1,2-dimethyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110950418 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N(C)C(C)C)cc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H30N4O2S/c1-17(2)25(5)28(26,27)20-13-11-18(12-14-20)15-23-21(22-3)24(4)16-19-9-7-6-8-10-19/h6-14,17H,15-16H2,1-5H3,(H,22,23) |
| InChIKey | TWWYXUIURGKCHQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|