C21H26IN5 — CID 110951259
1-benzyl-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 110951259) has the molecular formula C21H26IN5 and a molecular weight of 475.38 g/mol. Its IUPAC name is 1-benzyl-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-benzyl-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110951259 |
| Molecular Formula | C21H26IN5 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1-benzyl-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(Cn2ccnc2)cc1)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C21H25N5.HI/c1-22-21(25(2)15-19-6-4-3-5-7-19)24-14-18-8-10-20(11-9-18)16-26-13-12-23-17-26;/h3-13,17H,14-16H2,1-2H3,(H,22,24);1H |
| InChIKey | LWKGUFIYVHILCG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|