C23H28IN5 — CID 111855673
1-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 111855673) has the molecular formula C23H28IN5 and a molecular weight of 501.42 g/mol. Its IUPAC name is 1-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111855673 |
| Molecular Formula | C23H28IN5 |
| Molecular Weight | 501.42 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 1-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(Cn2ccnc2)cc1)NCC1(c2ccccc2)CC1.I |
| InChI | InChI=1S/C23H27N5.HI/c1-24-22(27-17-23(11-12-23)21-5-3-2-4-6-21)26-15-19-7-9-20(10-8-19)16-28-14-13-25-18-28;/h2-10,13-14,18H,11-12,15-17H2,1H3,(H2,24,26,27);1H |
| InChIKey | UBTQFHGLLWHCCI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|