C15H25IN4O — CID 110954723
3-[(N-benzyl-N'-methylcarbamimidoyl)amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 110954723) has the molecular formula C15H25IN4O and a molecular weight of 404.30 g/mol. Its IUPAC name is 3-[(N-benzyl-N'-methylcarbamimidoyl)amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[(N-benzyl-N'-methylcarbamimidoyl)amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 110954723 |
| Molecular Formula | C15H25IN4O |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 3-[(N-benzyl-N'-methylcarbamimidoyl)amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)NC(C)C)NCc1ccccc1.I |
| InChI | InChI=1S/C15H24N4O.HI/c1-12(2)19-14(20)9-10-17-15(16-3)18-11-13-7-5-4-6-8-13;/h4-8,12H,9-11H2,1-3H3,(H,19,20)(H2,16,17,18);1H |
| InChIKey | IBCMVENKWGZPET-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|