C16H26N4O — CID 111152016
N-benzyl-3-[(N-butyl-N'-methylcarbamimidoyl)amino]propanamide (PubChem CID 111152016) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is N-benzyl-3-[(N-butyl-N'-methylcarbamimidoyl)amino]propanamide.
| Compound Name | N-benzyl-3-[(N-butyl-N'-methylcarbamimidoyl)amino]propanamide |
|---|---|
| PubChem CID | 111152016 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | N-benzyl-3-[(N-butyl-N'-methylcarbamimidoyl)amino]propanamide |
| SMILES | CCCCN/C(=N\C)NCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H26N4O/c1-3-4-11-18-16(17-2)19-12-10-15(21)20-13-14-8-6-5-7-9-14/h5-9H,3-4,10-13H2,1-2H3,(H,20,21)(H2,17,18,19) |
| InChIKey | KFODJIPBIAHVOS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|