C20H25FN4O — CID 111228799
N-benzyl-3-[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 111228799) has the molecular formula C20H25FN4O and a molecular weight of 356.45 g/mol. Its IUPAC name is N-benzyl-3-[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | N-benzyl-3-[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111228799 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-benzyl-3-[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)NCc1ccccc1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN4O/c1-22-20(23-13-11-16-7-9-18(21)10-8-16)24-14-12-19(26)25-15-17-5-3-2-4-6-17/h2-10H,11-15H2,1H3,(H,25,26)(H2,22,23,24) |
| InChIKey | ACLHHNWGGMHKKS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|