C9H12O5 — CID 11095628
(4aR,5S,6R)-5,6-dihydroxy-7-(hydroxymethyl)-4,4a,5,6-tetrahydro-3H-cyclopenta[c]pyran-1-one (PubChem CID 11095628) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (4aR,5S,6R)-5,6-dihydroxy-7-(hydroxymethyl)-4,4a,5,6-tetrahydro-3H-cyclopenta[c]pyran-1-one.
| Compound Name | (4aR,5S,6R)-5,6-dihydroxy-7-(hydroxymethyl)-4,4a,5,6-tetrahydro-3H-cyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 11095628 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (4aR,5S,6R)-5,6-dihydroxy-7-(hydroxymethyl)-4,4a,5,6-tetrahydro-3H-cyclopenta[c]pyran-1-one |
| SMILES | O=C1OCC[C@@H]2C1=C(CO)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C9H12O5/c10-3-5-6-4(7(11)8(5)12)1-2-14-9(6)13/h4,7-8,10-12H,1-3H2/t4-,7+,8-/m1/s1 |
| InChIKey | ZTORISRLTYWNKJ-BTZDVCGTSA-N |
| XLogP | -1.43 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |