C9H16O3S — CID 11095730
ethyl (2R,3S)-3-hydroxy-2-methylthiane-2-carboxylate (PubChem CID 11095730) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is ethyl (2R,3S)-3-hydroxy-2-methylthiane-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-hydroxy-2-methylthiane-2-carboxylate |
|---|---|
| PubChem CID | 11095730 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | ethyl (2R,3S)-3-hydroxy-2-methylthiane-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)SCCC[C@@H]1O |
| InChI | InChI=1S/C9H16O3S/c1-3-12-8(11)9(2)7(10)5-4-6-13-9/h7,10H,3-6H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | ALJGGRCTEHEABO-IONNQARKSA-N |
| XLogP | 1.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |