C25H35N5O — CID 110959963
4-benzyl-N-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 110959963) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 4-benzyl-N-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110959963 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 4-benzyl-N-[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCN(c2cccc(OC)c2)C1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H35N5O/c1-26-25(29-15-13-28(14-16-29)19-21-7-4-3-5-8-21)27-18-22-11-12-30(20-22)23-9-6-10-24(17-23)31-2/h3-10,17,22H,11-16,18-20H2,1-2H3,(H,26,27) |
| InChIKey | WZNZAQFKBJQWBU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|