C24H31F2N5O — CID 111290595
N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111290595) has the molecular formula C24H31F2N5O and a molecular weight of 443.54 g/mol. Its IUPAC name is N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290595 |
| Molecular Formula | C24H31F2N5O |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCN(c2ccc(F)c(F)c2)C1)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C24H31F2N5O/c1-27-24(30-12-10-29(11-13-30)19-4-3-5-21(14-19)32-2)28-16-18-8-9-31(17-18)20-6-7-22(25)23(26)15-20/h3-7,14-15,18H,8-13,16-17H2,1-2H3,(H,27,28) |
| InChIKey | PXTVLKVCQLIUAF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|