C18H25F3N4O2 — CID 110963353
4-acetyl-N-ethyl-N'-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 110963353) has the molecular formula C18H25F3N4O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963353 |
| Molecular Formula | C18H25F3N4O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1C(F)(F)F)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H25F3N4O2/c1-4-22-17(25-9-7-24(8-10-25)13(2)26)23-12-14-5-6-15(27-3)11-16(14)18(19,20)21/h5-6,11H,4,7-10,12H2,1-3H3,(H,22,23) |
| InChIKey | HLSVBSLFFGWKFY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|