C12H16O5 — CID 11096713
6,6-dimethoxy-3,3-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one (PubChem CID 11096713) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 6,6-dimethoxy-3,3-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one.
| Compound Name | 6,6-dimethoxy-3,3-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one |
|---|---|
| PubChem CID | 11096713 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 6,6-dimethoxy-3,3-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one |
| SMILES | COC1(OC)C=CC=CC12OC(=O)C(C)(C)O2 |
| InChI | InChI=1S/C12H16O5/c1-10(2)9(13)16-12(17-10)8-6-5-7-11(12,14-3)15-4/h5-8H,1-4H3 |
| InChIKey | VOAHXHOHIAOFIS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|