C14H24O5 — CID 14381474
tert-butyl 2-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoxy]acetate (PubChem CID 14381474) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is tert-butyl 2-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoxy]acetate.
| Compound Name | tert-butyl 2-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoxy]acetate |
|---|---|
| PubChem CID | 14381474 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | tert-butyl 2-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COC/C=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H24O5/c1-13(2,3)19-12(15)10-16-8-6-7-11-9-17-14(4,5)18-11/h6-7,11H,8-10H2,1-5H3/b7-6+/t11-/m0/s1 |
| InChIKey | WLKJNJDTTRKPNE-MLRMMBSGSA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|