C9H12O4 — CID 70132262
[(1S,4S,5R)-4-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl] acetate (PubChem CID 70132262) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is [(1S,4S,5R)-4-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl] acetate.
| Compound Name | [(1S,4S,5R)-4-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl] acetate |
|---|---|
| PubChem CID | 70132262 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | [(1S,4S,5R)-4-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C)C=C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C9H12O4/c1-6(10)13-9(2)4-3-7-5-11-8(9)12-7/h3-4,7-8H,5H2,1-2H3/t7-,8+,9-/m0/s1 |
| InChIKey | XYIANIGNTYCXBO-YIZRAAEISA-N |
| XLogP | 0.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|