C22H31N5 — CID 110967468
2-methyl-1-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 110967468) has the molecular formula C22H31N5 and a molecular weight of 365.53 g/mol. Its IUPAC name is 2-methyl-1-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110967468 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 2-methyl-1-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccccn1)NCc1ccccc1CN1CCCC(C)C1 |
| InChI | InChI=1S/C22H31N5/c1-18-8-7-13-27(16-18)17-20-10-4-3-9-19(20)14-25-22(23-2)26-15-21-11-5-6-12-24-21/h3-6,9-12,18H,7-8,13-17H2,1-2H3,(H2,23,25,26) |
| InChIKey | HEQUCWAKTOKIRQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|