C24H35N7 — CID 111207468
N'-methyl-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111207468) has the molecular formula C24H35N7 and a molecular weight of 421.59 g/mol. Its IUPAC name is N'-methyl-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111207468 |
| Molecular Formula | C24H35N7 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | N'-methyl-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccccc1CN1CCCC(C)C1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C24H35N7/c1-20-7-5-12-29(18-20)19-22-9-4-3-8-21(22)17-28-23(25-2)30-13-15-31(16-14-30)24-26-10-6-11-27-24/h3-4,6,8-11,20H,5,7,12-19H2,1-2H3,(H,25,28) |
| InChIKey | RXKRPLYTNZCEKC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|