C19H27N5O2S — CID 110968014
2-methyl-1-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 110968014) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 2-methyl-1-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110968014 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-methyl-1-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(CS(=O)(=O)NC(C)C)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C19H27N5O2S/c1-15(2)24-27(25,26)14-17-9-7-16(8-10-17)12-22-19(20-3)23-13-18-6-4-5-11-21-18/h4-11,15,24H,12-14H2,1-3H3,(H2,20,22,23) |
| InChIKey | HNKCBUBQDCMLIX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|