C17H24IN5O2S — CID 110969589
2-methyl-1-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110969589) has the molecular formula C17H24IN5O2S and a molecular weight of 489.38 g/mol. Its IUPAC name is 2-methyl-1-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110969589 |
| Molecular Formula | C17H24IN5O2S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 2-methyl-1-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CS(=O)(=O)NC)cc1)NCc1ccccn1.I |
| InChI | InChI=1S/C17H23N5O2S.HI/c1-18-17(22-12-16-5-3-4-10-20-16)21-11-14-6-8-15(9-7-14)13-25(23,24)19-2;/h3-10,19H,11-13H2,1-2H3,(H2,18,21,22);1H |
| InChIKey | KYNJAFPMQOTKGK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|