C22H31ClN6 — CID 110968060
1-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 110968060) has the molecular formula C22H31ClN6 and a molecular weight of 414.99 g/mol. Its IUPAC name is 1-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110968060 |
| Molecular Formula | C22H31ClN6 |
| Molecular Weight | 414.99 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCCN1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H31ClN6/c1-2-24-22(27-18-19-8-5-6-11-25-19)26-12-7-13-28-14-16-29(17-15-28)21-10-4-3-9-20(21)23/h3-6,8-11H,2,7,12-18H2,1H3,(H2,24,26,27) |
| InChIKey | MVTVPJLEDXRYRG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|