C15H19NO2 — CID 11096870
[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-[(2R,3S)-3-phenyloxiran-2-yl]methanone (PubChem CID 11096870) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is [(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-[(2R,3S)-3-phenyloxiran-2-yl]methanone.
| Compound Name | [(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-[(2R,3S)-3-phenyloxiran-2-yl]methanone |
|---|---|
| PubChem CID | 11096870 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-[(2R,3S)-3-phenyloxiran-2-yl]methanone |
| SMILES | C[C@@H]1CC[C@@H](C)N1C(=O)[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c1-10-8-9-11(2)16(10)15(17)14-13(18-14)12-6-4-3-5-7-12/h3-7,10-11,13-14H,8-9H2,1-2H3/t10-,11-,13+,14-/m1/s1 |
| InChIKey | PYHYVROUXOFSKK-MHDGFBEUSA-N |
| XLogP | 2.53 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|