C19H22N6 — CID 110969018
1-ethyl-2-[(4-pyrazol-1-ylphenyl)methyl]-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 110969018) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-ethyl-2-[(4-pyrazol-1-ylphenyl)methyl]-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-2-[(4-pyrazol-1-ylphenyl)methyl]-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110969018 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-ethyl-2-[(4-pyrazol-1-ylphenyl)methyl]-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2cccn2)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C19H22N6/c1-2-20-19(23-15-17-6-3-4-11-21-17)22-14-16-7-9-18(10-8-16)25-13-5-12-24-25/h3-13H,2,14-15H2,1H3,(H2,20,22,23) |
| InChIKey | PBUIDENHEJMCBQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|