C18H24N4O3 — CID 110970855
2-methyl-1-(pyridin-2-ylmethyl)-3-[(2,4,6-trimethoxyphenyl)methyl]guanidine (PubChem CID 110970855) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-methyl-1-(pyridin-2-ylmethyl)-3-[(2,4,6-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(pyridin-2-ylmethyl)-3-[(2,4,6-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110970855 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-methyl-1-(pyridin-2-ylmethyl)-3-[(2,4,6-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccn1)NCc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C18H24N4O3/c1-19-18(21-11-13-7-5-6-8-20-13)22-12-15-16(24-3)9-14(23-2)10-17(15)25-4/h5-10H,11-12H2,1-4H3,(H2,19,21,22) |
| InChIKey | CCQVTVQJLSQWLE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|