C16H19NO2 — CID 11097222
4-(cyclohexylmethyl)-2-phenyl-4H-1,3-oxazol-5-one (PubChem CID 11097222) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-2-phenyl-4H-1,3-oxazol-5-one.
| Compound Name | 4-(cyclohexylmethyl)-2-phenyl-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 11097222 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-(cyclohexylmethyl)-2-phenyl-4H-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=NC1CC1CCCCC1 |
| InChI | InChI=1S/C16H19NO2/c18-16-14(11-12-7-3-1-4-8-12)17-15(19-16)13-9-5-2-6-10-13/h2,5-6,9-10,12,14H,1,3-4,7-8,11H2 |
| InChIKey | ZMZLGLBVUPIDJT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |