C10H4ClN3O2S — CID 11097466
3-chloro-5-(3-nitrophenyl)-1,2-thiazole-4-carbonitrile (PubChem CID 11097466) has the molecular formula C10H4ClN3O2S and a molecular weight of 265.68 g/mol. Its IUPAC name is 3-chloro-5-(3-nitrophenyl)-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-chloro-5-(3-nitrophenyl)-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 11097466 |
| Molecular Formula | C10H4ClN3O2S |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 3-chloro-5-(3-nitrophenyl)-1,2-thiazole-4-carbonitrile |
| SMILES | N#Cc1c(Cl)nsc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H4ClN3O2S/c11-10-8(5-12)9(17-13-10)6-2-1-3-7(4-6)14(15)16/h1-4H |
| InChIKey | DTRGHTSNCGJJJM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|