C8H6Cl2O2S2 — CID 11097571
(1R,2R,3S,6S,7R)-5,8-dichloro-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide (PubChem CID 11097571) has the molecular formula C8H6Cl2O2S2 and a molecular weight of 269.17 g/mol. Its IUPAC name is (1R,2R,3S,6S,7R)-5,8-dichloro-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide.
| Compound Name | (1R,2R,3S,6S,7R)-5,8-dichloro-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide |
|---|---|
| PubChem CID | 11097571 |
| Molecular Formula | C8H6Cl2O2S2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 267.92 |
| IUPAC Name | (1R,2R,3S,6S,7R)-5,8-dichloro-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide |
| SMILES | O=S1C2C=C(Cl)[C@H]1[C@H]1C(Cl)=C[S@](=O)[C@@H]21 |
| InChI | InChI=1S/C8H6Cl2O2S2/c9-3-1-5-8-6(7(3)14(5)12)4(10)2-13(8)11/h1-2,5-8H/t5?,6-,7+,8+,13+,14?/m1/s1 |
| InChIKey | WXIRXGBPWNQEBA-SCPBGFKNSA-N |
| XLogP | 1.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |