C8H7ClO2S2 — CID 10922476
(1R,2R,3R,6S,7R)-7-chloro-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide (PubChem CID 10922476) has the molecular formula C8H7ClO2S2 and a molecular weight of 234.73 g/mol. Its IUPAC name is (1R,2R,3R,6S,7R)-7-chloro-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide.
| Compound Name | (1R,2R,3R,6S,7R)-7-chloro-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide |
|---|---|
| PubChem CID | 10922476 |
| Molecular Formula | C8H7ClO2S2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | (1R,2R,3R,6S,7R)-7-chloro-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide |
| SMILES | O=S1C2C=C[C@@]1(Cl)[C@H]1C=C[S@@](=O)[C@@H]21 |
| InChI | InChI=1S/C8H7ClO2S2/c9-8-3-1-6(13(8)11)7-5(8)2-4-12(7)10/h1-7H/t5-,6?,7+,8-,12+,13?/m0/s1 |
| InChIKey | ABVFEVQUROVDQT-RRJMFTMOSA-N |
| XLogP | 0.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|