C8H8OS2 — CID 101238117
(1S,2S,6R,7R)-3,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 10-oxide (PubChem CID 101238117) has the molecular formula C8H8OS2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (1S,2S,6R,7R)-3,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 10-oxide.
| Compound Name | (1S,2S,6R,7R)-3,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 10-oxide |
|---|---|
| PubChem CID | 101238117 |
| Molecular Formula | C8H8OS2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | (1S,2S,6R,7R)-3,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 10-oxide |
| SMILES | O=S1C2C=C[C@H]1[C@H]1SC=C[C@@H]21 |
| InChI | InChI=1S/C8H8OS2/c9-11-6-1-2-7(11)8-5(6)3-4-10-8/h1-8H/t5-,6?,7-,8-,11?/m0/s1 |
| InChIKey | LZRUKOMZMLNCRX-XVQNCBBTSA-N |
| XLogP | 1.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|