C8H10S — CID 10773050
(1R,3R,4S)-3-ethenyl-2-thiabicyclo[2.2.1]hept-5-ene (PubChem CID 10773050) has the molecular formula C8H10S and a molecular weight of 138.23 g/mol. Its IUPAC name is (1R,3R,4S)-3-ethenyl-2-thiabicyclo[2.2.1]hept-5-ene.
| Compound Name | (1R,3R,4S)-3-ethenyl-2-thiabicyclo[2.2.1]hept-5-ene |
|---|---|
| PubChem CID | 10773050 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | (1R,3R,4S)-3-ethenyl-2-thiabicyclo[2.2.1]hept-5-ene |
| SMILES | C=C[C@H]1S[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C8H10S/c1-2-8-6-3-4-7(5-6)9-8/h2-4,6-8H,1,5H2/t6-,7+,8-/m1/s1 |
| InChIKey | BPGFVSNXYUYVDH-GJMOJQLCSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|