C10H16S — CID 10899091
5-cyclohexyl-2,3-dihydrothiophene (PubChem CID 10899091) has the molecular formula C10H16S and a molecular weight of 168.31 g/mol. Its IUPAC name is 5-cyclohexyl-2,3-dihydrothiophene.
| Compound Name | 5-cyclohexyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 10899091 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 5-cyclohexyl-2,3-dihydrothiophene |
| SMILES | C1=C(C2CCCCC2)SCC1 |
| InChI | InChI=1S/C10H16S/c1-2-5-9(6-3-1)10-7-4-8-11-10/h7,9H,1-6,8H2 |
| InChIKey | XSRLDOXJZXMURE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |