C9H12O2S2 — CID 10376025
(1R,1'S,3R,4'S)-spiro[1,3-dithiolane-2,5'-bicyclo[2.2.1]hept-2-ene] 1,3-dioxide (PubChem CID 10376025) has the molecular formula C9H12O2S2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (1R,1'S,3R,4'S)-spiro[1,3-dithiolane-2,5'-bicyclo[2.2.1]hept-2-ene] 1,3-dioxide.
| Compound Name | (1R,1'S,3R,4'S)-spiro[1,3-dithiolane-2,5'-bicyclo[2.2.1]hept-2-ene] 1,3-dioxide |
|---|---|
| PubChem CID | 10376025 |
| Molecular Formula | C9H12O2S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | (1R,1'S,3R,4'S)-spiro[1,3-dithiolane-2,5'-bicyclo[2.2.1]hept-2-ene] 1,3-dioxide |
| SMILES | O=[S@@]1CC[S@](=O)C12C[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C9H12O2S2/c10-12-3-4-13(11)9(12)6-7-1-2-8(9)5-7/h1-2,7-8H,3-6H2/t7-,8+,9?,12-,13+/m0/s1 |
| InChIKey | TUDIRAUWHULGRL-QNIRFNIQSA-N |
| XLogP | 0.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|