C8H12OS — CID 134896807
(1R,3R,4S)-3-ethyl-2λ4-thiabicyclo[2.2.1]hept-5-ene 2-oxide (PubChem CID 134896807) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is (1R,3R,4S)-3-ethyl-2λ4-thiabicyclo[2.2.1]hept-5-ene 2-oxide.
| Compound Name | (1R,3R,4S)-3-ethyl-2λ4-thiabicyclo[2.2.1]hept-5-ene 2-oxide |
|---|---|
| PubChem CID | 134896807 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (1R,3R,4S)-3-ethyl-2λ4-thiabicyclo[2.2.1]hept-5-ene 2-oxide |
| SMILES | CCC1[C@@H]2C=C[C@@H](C2)S1=O |
| InChI | InChI=1S/C8H12OS/c1-2-8-6-3-4-7(5-6)10(8)9/h3-4,6-8H,2,5H2,1H3/t6-,7+,8?,10?/m1/s1 |
| InChIKey | ZRUKPWFROTYNQM-CCSIGSMKSA-N |
| XLogP | 1.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|