C9H14S — CID 134994670
(1S,3R,4R)-3-propyl-2-thiabicyclo[2.2.1]hept-5-ene (PubChem CID 134994670) has the molecular formula C9H14S and a molecular weight of 154.28 g/mol. Its IUPAC name is (1S,3R,4R)-3-propyl-2-thiabicyclo[2.2.1]hept-5-ene.
| Compound Name | (1S,3R,4R)-3-propyl-2-thiabicyclo[2.2.1]hept-5-ene |
|---|---|
| PubChem CID | 134994670 |
| Molecular Formula | C9H14S |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | (1S,3R,4R)-3-propyl-2-thiabicyclo[2.2.1]hept-5-ene |
| SMILES | CCC[C@H]1S[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C9H14S/c1-2-3-9-7-4-5-8(6-7)10-9/h4-5,7-9H,2-3,6H2,1H3/t7-,8+,9+/m0/s1 |
| InChIKey | FPVBSIFAAQQFNG-DJLDLDEBSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|