C12H24IN3O2 — CID 110981184
1-ethyl-2-[(4-hydroxyoxan-4-yl)methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110981184) has the molecular formula C12H24IN3O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is 1-ethyl-2-[(4-hydroxyoxan-4-yl)methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-hydroxyoxan-4-yl)methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110981184 |
| Molecular Formula | C12H24IN3O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 1-ethyl-2-[(4-hydroxyoxan-4-yl)methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/CC1(O)CCOCC1)NCC.I |
| InChI | InChI=1S/C12H23N3O2.HI/c1-3-7-14-11(13-4-2)15-10-12(16)5-8-17-9-6-12;/h3,16H,1,4-10H2,2H3,(H2,13,14,15);1H |
| InChIKey | IYNFBPWGOCZOTJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|