C11H22IN3O2 — CID 137158975
2-[2-(4-hydroxyoxan-4-yl)ethyl]-1-prop-2-enylguanidine;hydroiodide (PubChem CID 137158975) has the molecular formula C11H22IN3O2 and a molecular weight of 355.22 g/mol. Its IUPAC name is 2-[2-(4-hydroxyoxan-4-yl)ethyl]-1-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[2-(4-hydroxyoxan-4-yl)ethyl]-1-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 137158975 |
| Molecular Formula | C11H22IN3O2 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[2-(4-hydroxyoxan-4-yl)ethyl]-1-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(N)=N/CCC1(O)CCOCC1.I |
| InChI | InChI=1S/C11H21N3O2.HI/c1-2-6-13-10(12)14-7-3-11(15)4-8-16-9-5-11;/h2,15H,1,3-9H2,(H3,12,13,14);1H |
| InChIKey | JZGLAPRKUWDMGB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|