C12H24N4O — CID 137136827
2-[2-(2,2-dimethylmorpholin-4-yl)ethyl]-1-prop-2-enylguanidine (PubChem CID 137136827) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylmorpholin-4-yl)ethyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[2-(2,2-dimethylmorpholin-4-yl)ethyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 137136827 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 2-[2-(2,2-dimethylmorpholin-4-yl)ethyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/CCN1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H24N4O/c1-4-5-14-11(13)15-6-7-16-8-9-17-12(2,3)10-16/h4H,1,5-10H2,2-3H3,(H3,13,14,15) |
| InChIKey | PJTILVOPUOZPQE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|