C12H26IN3O — CID 110981502
1-(3-butoxypropyl)-2-methyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110981502) has the molecular formula C12H26IN3O and a molecular weight of 355.26 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-methyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-(3-butoxypropyl)-2-methyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110981502 |
| Molecular Formula | C12H26IN3O |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-(3-butoxypropyl)-2-methyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCCCOCCCC.I |
| InChI | InChI=1S/C12H25N3O.HI/c1-4-6-10-16-11-7-9-15-12(13-3)14-8-5-2;/h5H,2,4,6-11H2,1,3H3,(H2,13,14,15);1H |
| InChIKey | WPRQRXNXBAKMBU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|