C11H21N3O — CID 109382928
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-prop-2-enylguanidine (PubChem CID 109382928) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-prop-2-enylguanidine.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 109382928 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\C)N(C)CC1CCOC1 |
| InChI | InChI=1S/C11H21N3O/c1-4-6-13-11(12-2)14(3)8-10-5-7-15-9-10/h4,10H,1,5-9H2,2-3H3,(H,12,13) |
| InChIKey | PIZIDYFDGJFXHR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|