C12H24FN3O — CID 109384070
3-ethyl-2-(3-fluoropropyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109384070) has the molecular formula C12H24FN3O and a molecular weight of 245.34 g/mol. Its IUPAC name is 3-ethyl-2-(3-fluoropropyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-ethyl-2-(3-fluoropropyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109384070 |
| Molecular Formula | C12H24FN3O |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3-ethyl-2-(3-fluoropropyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CCCF)N(C)CC1CCOC1 |
| InChI | InChI=1S/C12H24FN3O/c1-3-14-12(15-7-4-6-13)16(2)9-11-5-8-17-10-11/h11H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | VMZRJKCHKQRMHZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|